6-Bromo-3-chloropyrazine-2-carbonitrile - CAS 1257072-34-6
Catalog: |
BB006240 |
Product Name: |
6-Bromo-3-chloropyrazine-2-carbonitrile |
CAS: |
1257072-34-6 |
Synonyms: |
6-bromo-3-chloro-2-pyrazinecarbonitrile; 6-bromo-3-chloropyrazine-2-carbonitrile |
IUPAC Name: | 6-bromo-3-chloropyrazine-2-carbonitrile |
Description: | 6-Bromo-3-chloropyrazine-2-carbonitrile (CAS# 1257072-34-6) is a useful research chemical. |
Molecular Weight: | 218.44 |
Molecular Formula: | C5HBrClN3 |
Canonical SMILES: | C1=C(N=C(C(=N1)Cl)C#N)Br |
InChI: | InChI=1S/C5HBrClN3/c6-4-2-9-5(7)3(1-8)10-4/h2H |
InChI Key: | FAOLIJWZYYNLRZ-UHFFFAOYSA-N |
Appearance: | Low melting brown crystalline powder |
Storage: | Inert atmosphere, 2-8 ℃ |
MDL: | MFCD23097407 |
LogP: | 1.76418 |
Publication Number | Title | Priority Date |
WO-2021115286-A1 | Six-membered and five-membered aromatic ring derivative containing nitrogen heteroatoms which can be used as shp2 inhibitor | 20191210 |
CN-104402833-B | Pyrazine compounds containing cyclobutane substituent and combinations thereof thing and purposes | 20141120 |
CN-104447584-B | Pyrazine compounds containing cyclobutane substituent and combinations thereof thing and purposes | 20141120 |
CN-104447585-B | Pyrazine compounds and combinations thereof thing and purposes | 20141120 |
AU-2010303567-A1 | Heterocyclic compounds useful as PDK1 inhibitors | 20091006 |
Complexity: | 166 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 216.90424 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 216.90424 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 49.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS