1-Benzofuran-3-carbonitrile - CAS 55877-31-1
Catalog: |
BB029209 |
Product Name: |
1-Benzofuran-3-carbonitrile |
CAS: |
55877-31-1 |
Synonyms: |
3-benzofurancarbonitrile; 1-benzofuran-3-carbonitrile |
IUPAC Name: | 1-benzofuran-3-carbonitrile |
Description: | 1-Benzofuran-3-carbonitrile (CAS# 55877-31-1) is a useful research chemical. |
Molecular Weight: | 143.14 |
Molecular Formula: | C9H5NO |
Canonical SMILES: | C1=CC=C2C(=C1)C(=CO2)C#N |
InChI: | InChI=1S/C9H5NO/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6H |
InChI Key: | VLLADTXGBAUFMW-UHFFFAOYSA-N |
LogP: | 2.30448 |
Publication Number | Title | Priority Date |
WO-2020069625-A1 | Transcription factor brn2 inhibitory compounds as therapeutics and methods for their use | 20181003 |
EP-3860994-A1 | Transcription factor brn2 inhibitory compounds as therapeutics and methods for their use | 20181003 |
WO-2019133633-A1 | Composition including multiple terminally functionalized polymers | 20171230 |
EP-3732210-A1 | Composition including multiple terminally functionalized polymers | 20171230 |
US-2020369791-A1 | Composition Including Multiple Terminally Functionalized Polymers | 20171230 |
Complexity: | 193 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 143.037113783 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 143.037113783 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 36.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS