3-Aminobenzamide oxime - CAS 100524-07-0
Catalog: |
BB000252 |
Product Name: |
3-Aminobenzamide oxime |
CAS: |
100524-07-0 |
Synonyms: |
3-amino-N'-hydroxybenzenecarboximidamide |
IUPAC Name: | 3-amino-N'-hydroxybenzenecarboximidamide |
Description: | 3-Aminobenzamide oxime (CAS# 100524-07-0) is a useful research chemical. |
Molecular Weight: | 151.17 |
Molecular Formula: | C7H9N3O |
Canonical SMILES: | C1=CC(=CC(=C1)N)C(=NO)N |
InChI: | InChI=1S/C7H9N3O/c8-6-3-1-2-5(4-6)7(9)10-11/h1-4,11H,8H2,(H2,9,10) |
InChI Key: | OPGWBTKZYLRPRW-UHFFFAOYSA-N |
Boiling Point: | 413.8 °C at 760 mmHg |
Purity: | 97 % |
Density: | 1.34 g/cm3 |
Appearance: | Solid |
MDL: | MFCD08061150 |
LogP: | 1.64480 |
GHS Hazard Statement: | H301 (90.48%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
AU-2015342021-A1 | Piperidinylpyrazolopyrimidinones and their use | 20141103 |
AU-2015342021-B2 | Piperidinylpyrazolopyrimidinones and their use | 20141103 |
BR-112017009207-A2 | piperidinylpyrazolopyrimidinones and their use | 20141103 |
CA-2966259-A1 | Piperidinylpyrazolopyrimidinones and their use | 20141103 |
EP-3215505-A1 | Piperidinylpyrazolopyrimidinones and their use | 20141103 |
Complexity: | 158 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 1 |
Exact Mass: | 151.074561919 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 151.074561919 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 84.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS