5-Bromo-2-iodothiazole - CAS 108306-64-5
Catalog: |
BB002241 |
Product Name: |
5-Bromo-2-iodothiazole |
CAS: |
108306-64-5 |
Synonyms: |
5-bromo-2-iodothiazole; 5-bromo-2-iodo-1,3-thiazole |
IUPAC Name: | 5-bromo-2-iodo-1,3-thiazole |
Description: | 5-Bromo-2-iodothiazole (CAS# 108306-64-5) is a useful research chemical. |
Molecular Weight: | 289.92 |
Molecular Formula: | C3HBrINS |
Canonical SMILES: | C1=C(SC(=N1)I)Br |
InChI: | InChI=1S/C3HBrINS/c4-2-1-6-3(5)7-2/h1H |
InChI Key: | KYEQBVRCNVCFOF-UHFFFAOYSA-N |
Boiling Point: | 299.242 ℃ at 760 mmHg |
Density: | 2.626 g/cm3 |
LogP: | 2.51020 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021087181-A1 | Substituted pyrazole compounds as toll receptor inhibitors | 20191101 |
AU-2016217851-A1 | 1-(het)arylsulfonyl-(pyrrolidine or piperidine)-2-carboxamide derivatives and their use as TRPA1 antagonists | 20150215 |
CA-2975196-A1 | 1-(het)arylsulfonyl-(pyrrolidine or piperidine)-2-carboxamide derivatives and their use as trpa1 antagonists | 20150215 |
EP-3256463-A1 | 1-(het)arylsulfonyl-(pyrrolidine or piperidine)-2-carboxamide derivatives and their use as trpa1 antagonists | 20150215 |
EP-3256463-B1 | 1-(het)arylsulfonyl-(pyrrolidine or piperidine)-2-carboxamide derivatives and their use as trpa1 antagonists | 20150215 |
Complexity: | 72 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 288.80578 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 288.80578 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 41.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxazole/Thiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS