2-Bromo-5-fluoro-3-nitropyridine - CAS 652160-72-0
Catalog: |
BB032669 |
Product Name: |
2-Bromo-5-fluoro-3-nitropyridine |
CAS: |
652160-72-0 |
Synonyms: |
2-bromo-5-fluoro-3-nitropyridine; 2-bromo-5-fluoro-3-nitropyridine |
IUPAC Name: | 2-bromo-5-fluoro-3-nitropyridine |
Description: | 2-Bromo-5-fluoro-3-nitropyridine (CAS# 652160-72-0) is a useful research chemical. |
Molecular Weight: | 220.98 |
Molecular Formula: | C5H2BrFN2O2 |
Canonical SMILES: | C1=C(C(=NC=C1F)Br)[N+](=O)[O-] |
InChI: | InChI=1S/C5H2BrFN2O2/c6-5-4(9(10)11)1-3(7)2-8-5/h1-2H |
InChI Key: | XJFDIIHIXNIWQH-UHFFFAOYSA-N |
Boiling Point: | 227.3 ℃ at 760 mmHg |
Density: | 1.923 g/cm3 |
MDL: | MFCD05662387 |
LogP: | 2.41460 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3901152-A1 | Kv3 enhancers for the treatment of cognitive disorders | 20200423 |
AU-2017265769-A1 | Novel 5H-Pyrrolo(2,3-D)Pyrimidin-6(7H)-one derivative | 20160520 |
AU-2017265769-B2 | Novel 5H-Pyrrolo(2,3-D)Pyrimidin-6(7H)-one derivative | 20160520 |
AU-2017265769-B9 | Novel 5H-Pyrrolo(2,3-D)Pyrimidin-6(7H)-one derivative | 20160520 |
CA-3024831-A1 | Novel 5h-pyrrolo[2,3-d]pyrimidin-6(7h)-one derivative | 20160520 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 219.92837 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 219.92837 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS