3-Methyl-4-nitrobenzhydrazide - CAS 72198-83-5
Catalog: |
BB034568 |
Product Name: |
3-Methyl-4-nitrobenzhydrazide |
CAS: |
72198-83-5 |
Synonyms: |
3-methyl-4-nitrobenzohydrazide |
IUPAC Name: | 3-methyl-4-nitrobenzohydrazide |
Description: | 3-Methyl-4-nitrobenzhydrazide (CAS# 72198-83-5) is a useful research chemical compound. |
Molecular Weight: | 195.18 |
Molecular Formula: | C8H9N3O3 |
Canonical SMILES: | CC1=C(C=CC(=C1)C(=O)NN)[N+](=O)[O-] |
InChI: | InChI=1S/C8H9N3O3/c1-5-4-6(8(12)10-9)2-3-7(5)11(13)14/h2-4H,9H2,1H3,(H,10,12) |
InChI Key: | SMRIMKXHORAHJR-UHFFFAOYSA-N |
Density: | 1.345 g/cm3 |
MDL: | MFCD00220059 |
LogP: | 2.12110 |
GHS Hazard Statement: | H302 (90.48%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112079744-A | Aromatic acylhydrazone derivatives and application thereof as NA (adenosine) inhibitor | 20190613 |
CN-112079744-B | Aromatic acylhydrazone derivatives and application thereof as NA (adenosine) inhibitor | 20190613 |
US-2021005900-A1 | Method of generating energy from a hydrazide containing anode fuel, and fuel cell | 20190508 |
TW-201930258-A | Azo compound or salt thereof, and polarizing element, polarizing plate and display device containing the same | 20171222 |
US-10188642-B2 | Pharmacologically active compounds | 20120907 |
Complexity: | 239 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.06439116 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.06439116 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 101 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS