Triptycene - CAS 477-75-8
Catalog: |
BB026394 |
Product Name: |
Triptycene |
CAS: |
477-75-8 |
Synonyms: |
pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
IUPAC Name: | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
Description: | Triptycene, an aromatic hydrocarbon, is commonly used in some reactions as a molecular scaffold for its rigid structure. |
Molecular Weight: | 254.33 |
Molecular Formula: | C20H14 |
Canonical SMILES: | C1=CC=C2C3C4=CC=CC=C4C(C2=C1)C5=CC=CC=C35 |
InChI: | InChI=1S/C20H14/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19/h1-12,19-20H |
InChI Key: | NGDCLPXRKSWRPY-UHFFFAOYSA-N |
Boiling Point: | 371.8 ℃ at 760 mmHg |
Melting Point: | 252-256 ℃ |
Density: | 1.197 g/cm3 |
Appearance: | White solid |
LogP: | 4.67380 |
Publication Number | Title | Priority Date |
CN-113501776-A | Near-infrared luminous free radical cation compound and preparation and application thereof | 20210630 |
CN-113045734-A | Cationized super-crosslinked polymer organic porous nanosphere and hybrid anion exchange membrane thereof | 20210324 |
CN-112940047-A | Tripleene carbene palladium pyridine complex and application thereof | 20210226 |
CN-112979714-A | Triplecene carbene tridentate metal complex and application thereof | 20210226 |
CN-112961039-A | Tripleeneyne compound and low-voltage PDLC (polymer dispersed liquid crystal) composition | 20210219 |
PMID | Publication Date | Title | Journal |
23044486 | 20121121 | Complexation between triptycene-based macrotricyclic host and π-extended viologens: formation of supramolecular poly[3]pseudorotaxanes | Chemical communications (Cambridge, England) |
23044918 | 20121121 | Triptycene based luminescent metal-organic gels for chemosensing | Chemical communications (Cambridge, England) |
23030690 | 20121019 | Synthesis, structures, and solid state self-assemblies of formyl and acetyl substituted triptycenes and their derivatives | The Journal of organic chemistry |
22847697 | 20120915 | Isomeric differentiation of polycyclic aromatic hydrocarbons using silver nitrate reactive desorption electrospray ionization mass spectrometry | Rapid communications in mass spectrometry : RCM |
22751622 | 20120821 | A C2-symmetric, basic Fe(III) carboxylate complex derived from a novel triptycene-based chelating carboxylate ligand | Dalton transactions (Cambridge, England : 2003) |
Complexity: | 279 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 254.109550447 |
Formal Charge: | 0 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 254.109550447 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Arenes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS