Trimethyl Ethane-1,1,2-tricarboxylate - CAS 40967-67-7
Catalog: |
BB024735 |
Product Name: |
Trimethyl Ethane-1,1,2-tricarboxylate |
CAS: |
40967-67-7 |
Synonyms: |
ethane-1,1,2-tricarboxylic acid trimethyl ester; trimethyl ethane-1,1,2-tricarboxylate |
IUPAC Name: | trimethyl ethane-1,1,2-tricarboxylate |
Description: | Trimethyl Ethane-1,1,2-tricarboxylate (CAS# 40967-67-7) is a useful research chemical. |
Molecular Weight: | 204.18 |
Molecular Formula: | C8H12O6 |
Canonical SMILES: | COC(=O)CC(C(=O)OC)C(=O)OC |
InChI: | InChI=1S/C8H12O6/c1-12-6(9)4-5(7(10)13-2)8(11)14-3/h5H,4H2,1-3H3 |
InChI Key: | CFXNPIZDNPUMFS-UHFFFAOYSA-N |
Boiling Point: | 247.7 °C at 760 mmHg |
Density: | 1.191 g/cm3 |
MDL: | MFCD00015619 |
LogP: | -0.48830 |
Publication Number | Title | Priority Date |
JP-2017165770-A | Stabilizer compound, liquid crystal composition, and display element | 20150701 |
JP-6176420-B2 | Stabilizer compound, liquid crystal composition, and display element | 20150701 |
JP-WO2017002702-A1 | Stabilizer compound, liquid crystal composition, and display element | 20150701 |
US-10336939-B2 | Stabilizer compound, liquid crystal composition, and display device | 20150701 |
US-2018223188-A1 | Stabilizer compound, liquid crystal composition, and display device | 20150701 |
Complexity: | 218 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.0633881 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.0633881 |
Rotatable Bond Count: | 7 |
Topological Polar Surface Area: | 78.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS