Tetrakis(bromomethyl)ethene - CAS 30432-16-7
Catalog: |
BB020591 |
Product Name: |
Tetrakis(bromomethyl)ethene |
CAS: |
30432-16-7 |
Synonyms: |
1,4-dibromo-2,3-bis(bromomethyl)-2-butene; 1,4-dibromo-2,3-bis(bromomethyl)but-2-ene |
IUPAC Name: | 1,4-dibromo-2,3-bis(bromomethyl)but-2-ene |
Description: | 1,4-Dibromo-2,3-bis(bromomethyl)but-2-ene can be used as ubiquitin specific peptidase 9X inhibitors to treat cancer. |
Molecular Weight: | 399.74 |
Molecular Formula: | C6H8Br4 |
Canonical SMILES: | C(C(=C(CBr)CBr)CBr)Br |
InChI: | InChI=1S/C6H8Br4/c7-1-5(2-8)6(3-9)4-10/h1-4H2 |
InChI Key: | GJZKNORRVIUCCH-UHFFFAOYSA-N |
Boiling Point: | 376.9 °C at 760 mmHg |
Density: | 2.303 g/cm3 |
Appearance: | Solid |
MDL: | MFCD00017889 |
LogP: | 3.86260 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020191022-A1 | Inhibiting ubiquitin specific peptidase 9x | 20190318 |
WO-2021055668-A1 | Inhibiting ubiquitin specific peptidase 9x | 20190318 |
WO-2020139916-A1 | Inhibiting ubiquitin specific peptidase 9x | 20181226 |
CN-111196806-A | Guanidine derivatives and use thereof | 20181120 |
WO-2020061252-A1 | Inhibiting ubiquitin specific peptidase 9x | 20180919 |
PMID | Publication Date | Title | Journal |
20678958 | 20101015 | Synthesis, characterization and properties of tetra((1-hydroxyimino-methylnaphthalen-2-yloxy)methyl)ethene and its homo-dinuclear metal complexes: a combined experimental and theoretical investigation | Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy |
19325842 | 20080601 | Synthesis and characterization of some new tetraaldehyde and tetraketone derivatives and X-ray structure of 1,1'-(4,4'-(2-(1,3-bis(4-acetylphenoxy)propan-2-ylidene)propane-1,3-di-yl)bis(oxy)bis(4,1-phenylene))diethanone | International journal of molecular sciences |
Complexity: | 92.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 399.73185 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 395.73595 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS