Tetrahydrothiopyran-4-sulfonyl Chloride 1,1-Dioxide - CAS 1221722-37-7
Catalog: |
BB005355 |
Product Name: |
Tetrahydrothiopyran-4-sulfonyl Chloride 1,1-Dioxide |
CAS: |
1221722-37-7 |
Synonyms: |
1,1-dioxo-4-thianesulfonyl chloride; 1,1-dioxothiane-4-sulfonyl chloride |
IUPAC Name: | 1,1-dioxothiane-4-sulfonyl chloride |
Description: | Tetrahydrothiopyran-4-sulfonyl Chloride 1,1-Dioxide (CAS# 1221722-37-7) is a chemical reagent used in the synthesis of pharmaceutically active agents. |
Molecular Weight: | 232.71 |
Molecular Formula: | C5H9ClO4S2 |
Canonical SMILES: | C1CS(=O)(=O)CCC1S(=O)(=O)Cl |
InChI: | InChI=1S/C5H9ClO4S2/c6-12(9,10)5-1-3-11(7,8)4-2-5/h5H,1-4H2 |
InChI Key: | VVMQCBWGPRBGDH-UHFFFAOYSA-N |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2019359565-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
KR-20210010925-A | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
US-11136290-B2 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
EP-3328843-A1 | 1,3,4-oxadiazole sulfonamide derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20150727 |
US-2018251437-A1 | 1,3,4-oxadiazole sulfonamide derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20150727 |
Complexity: | 330 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.9630788 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.9630788 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 85 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
-
[3886-90-6]
N,N-dimethyloctadecanamide
-
[1271-47-2]
Ethynylferrocene
-
[70406-92-7]
N-(6-Amino-2,3-dichlorobenzyl)glycine ethyl ester
-
[92-06-8]
m-Terphenyl
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[79551-14-7]
Ferene Disodium Salt
INDUSTRY LEADERS TRUST OUR PRODUCTS