tert-Butyl trimethylsilylacetate - CAS 41108-81-0
Catalog: |
BB024785 |
Product Name: |
tert-Butyl trimethylsilylacetate |
CAS: |
41108-81-0 |
Synonyms: |
tert-butyl 2-trimethylsilylacetate |
IUPAC Name: | tert-butyl 2-trimethylsilylacetate |
Description: | tert-Butyl trimethylsilylacetate (CAS# 41108-81-0) is used to prepare lithium enolates, and is also a useful synthetic intermediate. |
Molecular Weight: | 188.34 |
Molecular Formula: | C9H20O2Si |
Canonical SMILES: | CC(C)(C)OC(=O)C[Si](C)(C)C |
InChI: | InChI=1S/C9H20O2Si/c1-9(2,3)11-8(10)7-12(4,5)6/h7H2,1-6H3 |
InChI Key: | HOHBQWITMXOSOW-UHFFFAOYSA-N |
Boiling Point: | 177 °C at 760 mmHg |
Density: | 0.86 g/cm3 |
LogP: | 2.66630 |
GHS Hazard Statement: | H226 (100%): Flammable liquid and vapor [Warning Flammable liquids] |
Precautionary Statement: | P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113265277-A | Clean synthetic fuel for ignition type engine | 20210603 |
AU-2012357969-A1 | Strigolactam derivatives as plant growth regulating compounds | 20111219 |
AU-2012357969-B2 | Strigolactam derivatives as plant growth regulating compounds | 20111219 |
BR-112014014916-B1 | "Strigolactam derivatives, their uses, plant growth regulating or seed germination promoting composition and methods for regulating plant growth, promoting seed germination, controlling weeds and improving crop plants." | 20111219 |
CA-2859282-A1 | Strigolactam derivatives as plant growth regulating compounds | 20111219 |
Complexity: | 162 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 188.123256411 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 188.123256411 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS