tert-Butyl 3-((5-bromo-3-formylpyridin-2-yloxy)methyl)pyrrolidine-1-carboxylate - CAS 1203499-20-0
Catalog: |
BB004803 |
Product Name: |
tert-Butyl 3-((5-bromo-3-formylpyridin-2-yloxy)methyl)pyrrolidine-1-carboxylate |
CAS: |
1203499-20-0 |
Synonyms: |
tert-butyl 3-[(5-bromo-3-formylpyridin-2-yl)oxymethyl]pyrrolidine-1-carboxylate |
IUPAC Name: | tert-butyl 3-[(5-bromo-3-formylpyridin-2-yl)oxymethyl]pyrrolidine-1-carboxylate |
Description: | tert-Butyl 3-((5-bromo-3-formylpyridin-2-yloxy)methyl)pyrrolidine-1-carboxylate (CAS# 1203499-20-0) is a useful research chemical. |
Molecular Weight: | 385.25 |
Molecular Formula: | C16H21BrN2O4 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CCC(C1)COC2=NC=C(C=C2C=O)Br |
InChI: | InChI=1S/C16H21BrN2O4/c1-16(2,3)23-15(21)19-5-4-11(8-19)10-22-14-12(9-20)6-13(17)7-18-14/h6-7,9,11H,4-5,8,10H2,1-3H3 |
InChI Key: | YAJQRHYUMDOISZ-UHFFFAOYSA-N |
MDL: | MFCD13176634 |
LogP: | 3.23030 |
Publication Number | Title | Priority Date |
EP-2797597-B1 | Substituted heteroaryl aldehyde compounds and methods for their use in increasing tissue oxygenation | 20111228 |
US-10377741-B2 | Substituted heteroaryl aldehyde compounds and methods for their use in increasing tissue oxygenation | 20111228 |
US-2013190316-A1 | Substituted heteroaryl aldehyde compounds and methods for their use in increasing tissue oxygenation | 20111228 |
US-2015344483-A1 | Substituted heteroaryl aldehyde compounds and methods for their use in increasing tissue oxygenation | 20111228 |
US-2017107199-A1 | Substituted heteroaryl aldehyde compounds and methods for their use in increasing tissue oxygenation | 20111228 |
Complexity: | 427 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 384.06847 |
Formal Charge: | 0 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 384.06847 |
Rotatable Bond Count: | 6 |
Topological Polar Surface Area: | 68.7 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyrrolidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS