S,S-Diphenylsulfilimine monohydrate - CAS 68837-61-6
Catalog: |
BB033645 |
Product Name: |
S,S-Diphenylsulfilimine monohydrate |
CAS: |
68837-61-6 |
Synonyms: |
imino(diphenyl)-lambda4-sulfane;hydrate |
IUPAC Name: | imino(diphenyl)-λ4-sulfane;hydrate |
Description: | S,S-Diphenylsulfilimine monohydrate (CAS# 68837-61-6) is a useful research chemical. |
Molecular Weight: | 219.30 |
Molecular Formula: | C12H13NOS |
Canonical SMILES: | C1=CC=C(C=C1)S(=N)C2=CC=CC=C2.O |
InChI: | InChI=1S/C12H11NS.H2O/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;1H2 |
InChI Key: | YLGYIQQZVOCMDO-UHFFFAOYSA-N |
Boiling Point: | 415.7 °C at 760 mmHg |
Purity: | > 95.0 % (T) |
MDL: | MFCD00149076 |
LogP: | 4.17130 |
GHS Hazard Statement: | H302 (97.44%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P273, P301+P312, P330, P391, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-2607361-A1 | Thiirane and michael acceptor compounds and their medical use | 20111220 |
US-2011027707-A1 | Sn containing hole blocking layer photoconductor | 20090729 |
US-8158315-B2 | SN containing hole blocking layer photoconductor | 20090729 |
AU-1069800-A | 3-azabicyclo(3.1.0.) hexane derivatives as opiate receptors ligands | 19981223 |
AU-761574-B2 | 3-azabicyclo(3.1.0.) hexane derivatives as opiate receptors ligands | 19981223 |
Complexity: | 171 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 219.07178521 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 219.07178521 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 44.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS