(S)-4-Aminochromane Hydrochloride - CAS 1035093-81-2
Catalog: |
BB001162 |
Product Name: |
(S)-4-Aminochromane Hydrochloride |
CAS: |
1035093-81-2 |
Synonyms: |
(4S)-3,4-dihydro-2H-1-benzopyran-4-amine;hydrochloride; (4S)-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
IUPAC Name: | (4S)-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
Description: | (S)-4-Aminochromane Hydrochloride (CAS# 1035093-81-2) is a useful research chemical. |
Molecular Weight: | 185.65 |
Molecular Formula: | C9H12ClNO |
Canonical SMILES: | C1COC2=CC=CC=C2C1N.Cl |
InChI: | InChI=1S/C9H11NO.ClH/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-4,8H,5-6,10H2;1H/t8-;/m0./s1 |
InChI Key: | BVMKYKMJUZEGBU-QRPNPIFTSA-N |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 2.97120 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021018839-A1 | Isoquinoline derivatives and their use for the treatment of parasitic infections | 20190730 |
WO-2020131629-A1 | Bicyclic derivatives | 20181218 |
WO-2020131631-A1 | Bicyclic derivatives | 20181218 |
CN-113490527-A | Bicyclic derivatives | 20181218 |
EP-3897842-A1 | Bicyclic derivatives | 20181218 |
Complexity: | 138 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.0607417 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.0607417 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 35.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzopyrans
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS