(S)-3-Methyl-2-butylamine Hydrochloride - CAS 31519-53-6
Catalog: |
BB020956 |
Product Name: |
(S)-3-Methyl-2-butylamine Hydrochloride |
CAS: |
31519-53-6 |
Synonyms: |
(2S)-3-methyl-2-butanamine;hydrochloride; (2S)-3-methylbutan-2-amine;hydrochloride |
IUPAC Name: | (2S)-3-methylbutan-2-amine;hydrochloride |
Description: | (S)-3-Methyl-2-butylamine Hydrochloride (CAS# 31519-53-6 ) is a useful research chemical. |
Molecular Weight: | 123.62 |
Molecular Formula: | C5H14ClN |
Canonical SMILES: | CC(C)C(C)N.Cl |
InChI: | InChI=1S/C5H13N.ClH/c1-4(2)5(3)6;/h4-5H,6H2,1-3H3;1H/t5-;/m0./s1 |
InChI Key: | RBOBXILUTBVQOQ-JEDNCBNOSA-N |
LogP: | 0.00000 |
Publication Number | Title | Priority Date |
AU-2006328948-A1 | Sulphonamidoaniline derivatives being Janus kinases inhibitors | 20051222 |
AU-2006328948-B2 | Sulphonamidoaniline derivatives being Janus kinases inhibitors | 20051222 |
BR-PI0620449-A2 | sulfonamidoaniline derivatives being inhibitors of janus kinases | 20051222 |
CA-2631721-A1 | Sulphonamidoaniline derivatives being janus kinases inhibitors | 20051222 |
CN-101331133-A | Sulphonamidoaniline derivatives being Janus kinases inhibitors | 20051222 |
Complexity: | 32.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 123.0814771 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 123.0814771 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS