(S)-3-(Cbz-amino)-2-pyrrolidinone - CAS 118507-50-9
Catalog: |
BB004124 |
Product Name: |
(S)-3-(Cbz-amino)-2-pyrrolidinone |
CAS: |
118507-50-9 |
Synonyms: |
N-[(3S)-2-oxo-3-pyrrolidinyl]carbamic acid (phenylmethyl) ester; benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate |
IUPAC Name: | benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate |
Description: | (S)-3-(Cbz-amino)-2-pyrrolidinone (CAS# 118507-50-9 ) is a useful research chemical. |
Molecular Weight: | 234.25 |
Molecular Formula: | C12H14N2O3 |
Canonical SMILES: | C1CNC(=O)C1NC(=O)OCC2=CC=CC=C2 |
InChI: | InChI=1S/C12H14N2O3/c15-11-10(6-7-13-11)14-12(16)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,15)(H,14,16)/t10-/m0/s1 |
InChI Key: | DAMJCWMGELCIMI-JTQLQIEISA-N |
Storage: | Sealed in dry, 2-8 °C |
LogP: | 1.28160 |
Publication Number | Title | Priority Date |
AU-2012357123-A1 | Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application | 20111221 |
AU-2012357123-B2 | Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application | 20111221 |
CA-2859575-A1 | Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application | 20111221 |
CN-104136030-A | Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application | 20111221 |
EP-2606893-A1 | Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application | 20111221 |
Complexity: | 288 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 234.10044231 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 234.10044231 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 67.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS