(S)-1-(3-Fluorophenyl)ethylamine - CAS 444643-09-8
Catalog: |
BB025618 |
Product Name: |
(S)-1-(3-Fluorophenyl)ethylamine |
CAS: |
444643-09-8 |
Synonyms: |
(1S)-1-(3-fluorophenyl)ethanamine; (1S)-1-(3-fluorophenyl)ethanamine |
IUPAC Name: | (1S)-1-(3-fluorophenyl)ethanamine |
Description: | (S)-1-(3-Fluorophenyl)ethylamine (CAS# 444643-09-8) is a useful research chemical. |
Molecular Weight: | 139.17 |
Molecular Formula: | C8H10FN |
Canonical SMILES: | CC(C1=CC(=CC=C1)F)N |
InChI: | InChI=1S/C8H10FN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3/t6-/m0/s1 |
InChI Key: | ASNVMKIDRJZXQZ-LURJTMIESA-N |
Boiling Point: | 0 ℃ |
Density: | 1.717 g/cm3 |
LogP: | 2.54570 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111285887-A | Spiro compound | 20200327 |
CN-111285887-B | Spiro compound | 20200327 |
WO-2021088901-A1 | Compounds as cd73 inhibitors | 20191105 |
WO-2021055326-A1 | Azole-fused pyridazin-3(2h)-one derivatives | 20190916 |
CN-112110941-A | Compound serving as Hippo signal pathway inhibitor | 20190621 |
Complexity: | 105 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 139.079727485 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 139.079727485 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS