(S)-(-)-1,2,3,4-Tetrahydro-3-isoquinolinemethanol - CAS 18881-17-9
Catalog: |
BB014550 |
Product Name: |
(S)-(-)-1,2,3,4-Tetrahydro-3-isoquinolinemethanol |
CAS: |
18881-17-9 |
Synonyms: |
[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol; [(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
IUPAC Name: | [(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
Description: | (S)-(-)-1,2,3,4-Tetrahydro-3-isoquinolinemethanol (CAS# 18881-17-9) is a useful research chemical. |
Molecular Weight: | 163.22 |
Molecular Formula: | C10H13NO |
Canonical SMILES: | C1C(NCC2=CC=CC=C21)CO |
InChI: | InChI=1S/C10H13NO/c12-7-10-5-8-3-1-2-4-9(8)6-11-10/h1-4,10-12H,5-7H2/t10-/m0/s1 |
InChI Key: | ZSKDXMLMMQFHGW-JTQLQIEISA-N |
Boiling Point: | 307.9 °C at 760 mmHg |
Density: | 1.081 g/cm3 |
MDL: | MFCD01631316 |
LogP: | 1.02200 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
TW-201934549-A | Benzodiazepine derivative | 20171228 |
WO-2019133652-A1 | Benzodiazepine derivatives | 20171228 |
EP-3732178-A1 | Benzodiazepine derivatives | 20171228 |
US-2020397914-A1 | Benzodiazepine derivatives | 20171228 |
US-2018346488-A1 | Cytotoxic benzodiazepine derivatives and conjugates thereof | 20170420 |
PMID | Publication Date | Title | Journal |
19562149 | 20090707 | Chirality-dependent hydrogen bond direction in jet-cooled (S)-1,2,3,4-tetrahydro-3-isoquinoline methanol (THIQM): IR-ion dip vibrational spectroscopy of the neutral and the ion | Physical chemistry chemical physics : PCCP |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 163.099714038 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 163.099714038 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 32.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS