rel-1-benzyl 2-methyl (1R,2S)-4-oxocyclopentane-1,2-dicarboxylate - CAS 164916-54-5
Catalog: |
BB012148 |
Product Name: |
rel-1-benzyl 2-methyl (1R,2S)-4-oxocyclopentane-1,2-dicarboxylate |
CAS: |
164916-54-5 |
Synonyms: |
(1S,2R)-4-oxocyclopentane-1,2-dicarboxylic acid O1-methyl ester O2-(phenylmethyl) ester; 2-O-benzyl 1-O-methyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate |
IUPAC Name: | 2-O-benzyl 1-O-methyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate |
Description: | rel-1-benzyl 2-methyl (1R,2S)-4-oxocyclopentane-1,2-dicarboxylate (CAS# 164916-54-5 ) is a useful research chemical. |
Molecular Weight: | 276.288 |
Molecular Formula: | C15H16O5 |
Canonical SMILES: | COC(=O)C1CC(=O)CC1C(=O)OCC2=CC=CC=C2 |
InChI: | InChI=1S/C15H16O5/c1-19-14(17)12-7-11(16)8-13(12)15(18)20-9-10-5-3-2-4-6-10/h2-6,12-13H,7-9H2,1H3/t12-,13+/m0/s1 |
InChI Key: | IPBOISVEVUERBN-QWHCGFSZSA-N |
LogP: | 1.49810 |
Publication Number | Title | Priority Date |
US-2003087882-A1 | Spiro-cyclic beta-amino acid derivatives as inhibitors of matrix metalloproteases and TNF-alpha converting enzyme (TACE) | 20010315 |
US-2004132693-A1 | Spiro-cyclic beta-amino acid derivatives as inhibitors of matrix metalloproteases and TNF-alpha converting enzyme (TACE) | 20010315 |
US-6720329-B2 | Spiro-cyclic β-amino acid derivatives as inhibitors of matrix metalloproteases and TNF-α converting enzyme (TACE) | 20010315 |
US-6962938-B2 | Spiro-cyclic β-amino acid derivatives as inhibitors of matrix metalloproteases and TNF-α converting enzyme (TACE) | 20010315 |
WO-02074738-A2 | Spiro-cyclic beta-amino acid derivatives as inhibitors of matrix metalloproteinases and tnf-alpha converting enzyme (tage) | 20010315 |
Complexity: | 384 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 276.09977361 |
Formal Charge: | 0 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 276.09977361 |
Rotatable Bond Count: | 6 |
Topological Polar Surface Area: | 69.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Cyclopentane
Customers Also Viewed
-
[138169-43-4]
MTS Reagent
-
[75726-96-4]
2-Bromo-N-isopropylacetamide
-
[55408-10-1]
Ethyl Tetrazole-5-carboxylate
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[163702-08-7]
Methyl perfluoroisobutyl ether
-
[10340-23-5]
cis-3-Nonen-1-ol
INDUSTRY LEADERS TRUST OUR PRODUCTS