(R)-7-Hydroxy-1,4-dioxaspiro[4.5]decan-8-one - CAS 851764-31-3
Catalog: |
BB037523 |
Product Name: |
(R)-7-Hydroxy-1,4-dioxaspiro[4.5]decan-8-one |
CAS: |
851764-31-3 |
Synonyms: |
(7R)-7-hydroxy-1,4-dioxaspiro[4.5]decan-8-one; (7R)-7-hydroxy-1,4-dioxaspiro[4.5]decan-8-one |
IUPAC Name: | (7R)-7-hydroxy-1,4-dioxaspiro[4.5]decan-8-one |
Description: | (R)-7-Hydroxy-1,4-dioxaspiro[4.5]decan-8-one (CAS# 851764-31-3 ) is a useful research chemical. |
Molecular Weight: | 172.18 |
Molecular Formula: | C8H12O4 |
Canonical SMILES: | C1CC2(CC(C1=O)O)OCCO2 |
InChI: | InChI=1S/C8H12O4/c9-6-1-2-8(5-7(6)10)11-3-4-12-8/h7,10H,1-5H2/t7-/m1/s1 |
InChI Key: | OVTNSAGYNLKXNZ-SSDOTTSWSA-N |
LogP: | -0.15660 |
Publication Number | Title | Priority Date |
AU-2012271759-A1 | 3-desoxy-2-methylene-19-nor-vitamin D analogs and their uses | 20110614 |
CA-2824870-A1 | 3-desoxy-2-methylene-19-nor-vitamin d analogs and their uses | 20110614 |
CA-2824870-C | 3-desoxy-2-methylene-19-nor-vitamin d analogs and their uses | 20110614 |
EP-2721004-B1 | 3-desoxy-2-methylene-19-nor-vitamin d analogs and their uses | 20110614 |
JP-2014523419-A | 3-Desoxy-2-methylene-19-nor-vitamin D analogues and their use | 20110614 |
Complexity: | 195 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.07355886 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.07355886 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 55.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS