(R)-6-(Hydroxymethyl)morpholin-3-one - CAS 919286-65-0
Catalog: |
BB040384 |
Product Name: |
(R)-6-(Hydroxymethyl)morpholin-3-one |
CAS: |
919286-65-0 |
Synonyms: |
(6R)-6-(hydroxymethyl)-3-morpholinone; (6R)-6-(hydroxymethyl)morpholin-3-one |
IUPAC Name: | (6R)-6-(hydroxymethyl)morpholin-3-one |
Description: | (R)-6-(Hydroxymethyl)morpholin-3-one (CAS# 919286-65-0 ) is a useful research chemical. |
Molecular Weight: | 131.13 |
Molecular Formula: | C5H9NO3 |
Canonical SMILES: | C1C(OCC(=O)N1)CO |
InChI: | InChI=1S/C5H9NO3/c7-2-4-1-6-5(8)3-9-4/h4,7H,1-3H2,(H,6,8)/t4-/m1/s1 |
InChI Key: | DMELBDGPDOJCTC-SCSAIBSYSA-N |
LogP: | -1.17750 |
Publication Number | Title | Priority Date |
CN-103102342-A | Aminoquinazoline derivative, salts thereof and application method | 20111114 |
CN-103102342-B | Aminoquinazoline derivative, salts thereof and application method | 20111114 |
AU-2008306625-A1 | Pyrazin-2-yl-pyridin-2-yl-amine and pyrazin-2-yl-pyrimidin-4-yl-amine compounds and their use | 20071005 |
AU-2008306625-B2 | Pyrazin-2-yl-pyridin-2-yl-amine and pyrazin-2-yl-pyrimidin-4-yl-amine compounds and their use | 20071005 |
CA-2738980-A1 | Pyrazin-2-yl-pyridin-2-yl-amine and pyrazin-2-yl-pyrimidin-4-yl-amine compounds and their use | 20071005 |
Complexity: | 115 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 131.058243149 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 131.058243149 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 58.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS