(R)-2-Amino-2-(4-fluorophenyl)ethanol - CAS 174770-74-2
Catalog: |
BB013041 |
Product Name: |
(R)-2-Amino-2-(4-fluorophenyl)ethanol |
CAS: |
174770-74-2 |
Synonyms: |
(2R)-2-amino-2-(4-fluorophenyl)ethanol; (2R)-2-amino-2-(4-fluorophenyl)ethanol |
IUPAC Name: | (2R)-2-amino-2-(4-fluorophenyl)ethanol |
Description: | (R)-2-Amino-2-(4-fluorophenyl)ethanol (CAS# 174770-74-2) is a useful research chemical. |
Molecular Weight: | 155.17 |
Molecular Formula: | C8H10FNO |
Canonical SMILES: | C1=CC(=CC=C1C(CO)N)F |
InChI: | InChI=1S/C8H10FNO/c9-7-3-1-6(2-4-7)8(10)5-11/h1-4,8,11H,5,10H2/t8-/m0/s1 |
InChI Key: | SRQPEYLZIUEVIA-QMMMGPOBSA-N |
Purity: | ≥ 98 %, ≥ 95 % e.e. |
LogP: | 1.51810 |
Publication Number | Title | Priority Date |
WO-2021071843-A1 | Muscarinic acetylcholine m1 receptor antagonists | 20191007 |
CA-2856204-A1 | Heterocyclic derivatives as trace amine associated receptors (taars) | 20120112 |
CN-104024250-A | Heterocyclic derivatives as trace amine associated receptors (taars) | 20120112 |
CN-104024250-B | As the Hete rocyclic derivatives of trace amine associated receptors (TAAR) | 20120112 |
EP-2802578-A1 | Heterocyclic derivatives as trace amine associated receptors (taars) | 20120112 |
Complexity: | 113 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 155.074642105 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 155.074642105 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 46.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS