(R)-2-(3-Fluorophenyl)pyrrolidine Hydrochloride - CAS 1364890-61-8
Catalog: |
BB008365 |
Product Name: |
(R)-2-(3-Fluorophenyl)pyrrolidine Hydrochloride |
CAS: |
1364890-61-8 |
Synonyms: |
(2R)-2-(3-fluorophenyl)pyrrolidine;hydrochloride; (2R)-2-(3-fluorophenyl)pyrrolidine;hydrochloride |
IUPAC Name: | (2R)-2-(3-fluorophenyl)pyrrolidine;hydrochloride |
Description: | (R)-2-(3-Fluorophenyl)pyrrolidine Hydrochloride acts as a reagent for the preparation, pan-TRK inhibitory activity, and SAR of phenylpyrrolidinyl imidazopyridazines. |
Molecular Weight: | 201.67 |
Molecular Formula: | C10H13ClFN |
Canonical SMILES: | C1CC(NC1)C2=CC(=CC=C2)F.Cl |
InChI: | InChI=1S/C10H12FN.ClH/c11-9-4-1-3-8(7-9)10-5-2-6-12-10;/h1,3-4,7,10,12H,2,5-6H2;1H/t10-;/m1./s1 |
InChI Key: | IXZAULRSYOOKSM-HNCPQSOCSA-N |
MDL: | MFCD08751398 |
LogP: | 3.38100 |
Publication Number | Title | Priority Date |
WO-2020035557-A1 | Novel heteroaromatic modulators of the retinoid-related orphan receptor gamma | 20180817 |
AU-2011299026-A1 | Imidazo [1, 2] pyridazin compounds and compositions asTRK inhibitors | 20100909 |
CA-2810858-A1 | Imidazo [1, 2] pyridazin compounds and compositions as trk inhibitors | 20100909 |
EP-2614062-A1 | Imidazo [1, 2]pyridazin compounds and compositions as trk inhibitors | 20100909 |
JP-2013537199-A | Imidazo [1,2] pyridazine compounds and compositions as TRK inhibitors | 20100909 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.0720553 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.0720553 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyrrolidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS