(R)-1-(Tetrahydro-2H-pyran-4-yl)ethanamine - CAS 1269755-01-2
Catalog: |
BB056866 |
Product Name: |
(R)-1-(Tetrahydro-2H-pyran-4-yl)ethanamine |
CAS: |
1269755-01-2 |
Synonyms: |
(αR)-Tetrahydro-α-methyl-2H-pyran-4-methanamine |
IUPAC Name: | (1R)-1-(oxan-4-yl)ethanamine |
Description: | (R)-1-(Tetrahydro-2H-pyran-4-yl)ethanamine is used in the prepartion of novel 3-quinoline carboxamides as potent, selective and orally bioavailable inhibitors of Ataxia Telangiectasia Mutated (ATM) Kinase. |
Molecular Weight: | 129.2 |
Molecular Formula: | C7H15NO |
Canonical SMILES: | CC(C1CCOCC1)N |
InChI: | InChI=1S/C7H15NO/c1-6(8)7-2-4-9-5-3-7/h6-7H,2-5,8H2,1H3/t6-/m1/s1 |
InChI Key: | WMPAKQDIADKRAQ-ZCFIWIBFSA-N |
References: | Degorce, Sebastien L., et al. J Med Chem., 59, 628 (2016). |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CA-3017035-A1 | Cinnolin-4-amine compounds and their use in treating cancer | 20160321 |
JP-2019512512-A | Cinnolin-4-amine compounds and their use in cancer treatment | 20160321 |
KR-20180127419-A | Cinnolin-4-amine compounds and uses thereof for treating cancer | 20160321 |
US-2019099421-A1 | Cinnolin-4-amine compounds and their use in treating cancer | 20160321 |
EP-3168219-A1 | Pyridone derivative having tetrahydropyranyl methyl group | 20140707 |
US-10442797-B2 | Pyridone derivatives having tetrahydropyranylmethyl groups | 20140707 |
US-2017183329-A1 | Pyridone derivative having tetrahydropyranylmethyl group | 20140707 |
US-2018148436-A2 | Pyridone derivatives having tetrahydropyranylmethyl groups | 20140707 |
US-2020010458-A1 | Pyridone derivatives having tetrahydropyranylmethyl groups | 20140707 |
EP-3168219-B1 | Pyridone derivative having tetrahydropyranyl methyl group | 20140707 |
Complexity: | 79 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 129.115364102 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 129.115364102 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35.2Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS