(R)-1-(m-Tolyl)ethanol - CAS 42070-91-7
Catalog: |
BB025035 |
Product Name: |
(R)-1-(m-Tolyl)ethanol |
CAS: |
42070-91-7 |
Synonyms: |
(1R)-1-(3-methylphenyl)ethanol; (1R)-1-(3-methylphenyl)ethanol |
IUPAC Name: | (1R)-1-(3-methylphenyl)ethanol |
Description: | (R)-1-(m-Tolyl)ethanol (CAS# 42070-91-7) is a useful research chemical. |
Molecular Weight: | 136.19 |
Molecular Formula: | C9H12O |
Canonical SMILES: | CC1=CC(=CC=C1)C(C)O |
InChI: | InChI=1S/C9H12O/c1-7-4-3-5-9(6-7)8(2)10/h3-6,8,10H,1-2H3/t8-/m1/s1 |
InChI Key: | SPNHUMWMKXWVIU-MRVPVSSYSA-N |
Purity: | ≥ 98 %, ≥ 95 % e.e. |
LogP: | 2.04830 |
Publication Number | Title | Priority Date |
CN-104262093-A | R-1-(3-methylphenyl)ethanol and synthesis of ester thereof | 20141009 |
US-2015290634-A1 | Catalyst and Process for Synthesising the Same | 20121102 |
US-9321045-B2 | Catalyst and process for synthesising the same | 20121102 |
AU-2010256501-A1 | Polycyclic antagonists of lysophosphatidic acid receptors | 20090603 |
AU-2010256501-B2 | Polycyclic antagonists of lysophosphatidic acid receptors | 20090603 |
Complexity: | 101 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 136.088815002 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 136.088815002 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 20.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS