Quinuclidine-4-carbonitrile - CAS 26458-78-6
Catalog: |
BB019292 |
Product Name: |
Quinuclidine-4-carbonitrile |
CAS: |
26458-78-6 |
Synonyms: |
1-azabicyclo[2.2.2]octane-4-carbonitrile; 1-azabicyclo[2.2.2]octane-4-carbonitrile |
IUPAC Name: | 1-azabicyclo[2.2.2]octane-4-carbonitrile |
Description: | Quinuclidine-4-carbonitrile (CAS# 26458-78-6) is an intermediate used to prepare pleuromutilin (P610500) derivatives as antimicrobials. |
Molecular Weight: | 136.19 |
Molecular Formula: | C8H12N2 |
Canonical SMILES: | C1CN2CCC1(CC2)C#N |
InChI: | InChI=1S/C8H12N2/c9-7-8-1-4-10(5-2-8)6-3-8/h1-6H2 |
InChI Key: | CEMKLAOKVLRABO-UHFFFAOYSA-N |
Boiling Point: | 238.7 °C at 760 mmHg |
Density: | 1.09 g/cm3 |
LogP: | 0.93378 |
Publication Number | Title | Priority Date |
WO-2021081272-A1 | Progranulin modulators and methods of using the same | 20191025 |
WO-2021030711-A1 | Alkynyl quinazoline compounds | 20190815 |
WO-2020252222-A1 | Progranulin modulators and methods of using the same | 20190612 |
WO-2020068867-A1 | Quinazoline derivatives as tyrosine kinase inhibitor, compositions, methods of making them and their use | 20180925 |
CN-113382986-A | Tyrosine kinase inhibitor compositions, methods of making and methods of using the same | 20180925 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 136.100048391 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 136.100048391 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 27 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS