Pyrimidine-2-carbonyl Chloride - CAS 220769-83-5
Catalog: |
BB017345 |
Product Name: |
Pyrimidine-2-carbonyl Chloride |
CAS: |
220769-83-5 |
Synonyms: |
2-pyrimidinecarbonyl chloride; pyrimidine-2-carbonyl chloride |
IUPAC Name: | pyrimidine-2-carbonyl chloride |
Description: | Pyrimidine-2-carbonyl Chloride (CAS# 220769-83-5 ) is a useful research chemical. |
Molecular Weight: | 142.54 |
Molecular Formula: | C5H3ClN2O |
Canonical SMILES: | C1=CN=C(N=C1)C(=O)Cl |
InChI: | InChI=1S/C5H3ClN2O/c6-4(9)5-7-2-1-3-8-5/h1-3H |
InChI Key: | FOVRZAGACROHCK-UHFFFAOYSA-N |
MDL: | MFCD18816666 |
LogP: | 0.85560 |
Publication Number | Title | Priority Date |
CN-111253339-A | Synthesis and preparation method of novel curcumin derivative and application of curcumin derivative in cancer treatment | 20191216 |
AU-2018323459-A1 | Spirocycle compounds and methods of making and using same | 20170829 |
CA-3072923-A1 | Spirocycle compounds and methods of making and using same | 20170829 |
CN-111050765-A | Spiro compounds and methods of making and using the same | 20170829 |
KR-20200046061-A | Spirocycle compounds and methods of making and using them | 20170829 |
Complexity: | 112 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 141.9933904 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 141.9933904 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS