pyrazolo[1,5-a]pyrazin-4-ol - CAS 1301714-00-0
Catalog: |
BB057933 |
Product Name: |
pyrazolo[1,5-a]pyrazin-4-ol |
CAS: |
1301714-00-0 |
Synonyms: |
pyrazolo[1,5-a]pyrazin-4(5h)-one; 4H,5H-pyrazolo[1,5-a]pyrazin-4-one; 5H-pyrazolo[1,5-a]pyrazin-4-one; pyrazolo[1,5-a]pyrazin-4-ol |
IUPAC Name: | 5H-pyrazolo[1,5-a]pyrazin-4-one |
Molecular Weight: | 135.1 |
Molecular Formula: | C6H5N3O |
Canonical SMILES: | C1=CN2C(=CC=N2)C(=O)N1 |
InChI: | InChI=1S/C6H5N3O/c10-6-5-1-2-8-9(5)4-3-7-6/h1-4H,(H,7,10) |
InChI Key: | YORUZNSCSKMAMN-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CA-3090150-A1 | Ahr modulators | 20180206 |
KR-20200090843-A | 6, 7-dihydro pyrazolo[1, 5-a]pyrazinone derivatives and pharmaceutical uses thereof | 20171124 |
CN-108948019-A | Focal adhesion kinase inhibitor and application thereof | 20170518 |
CA-3049136-A1 | Substituted pyrazolo[1,5-a]pyrazine compounds as ret kinase inhibitors | 20170118 |
CN-110267960-A | Substituted pyrazolo [1,5-a] pyrazine compound as RET kinase inhibitor | 20170118 |
KR-20180103158-A | Pyrazolo [1,5-a] pyrazin-4-yl derivative | 20160224 |
JP-2018536685-A | Heteroaromatic NMDA receptor modulators and uses thereof | 20151209 |
US-10626122-B2 | Heteroaromatic NMDA receptor modulators and uses thereof | 20151209 |
US-2018362541-A1 | Heteroaromatic nmda receptor modulators and uses thereof | 20151209 |
US-2021107916-A1 | Heteroaromatic nmda receptor modulators and uses thereof | 20151209 |
PMID | Publication Date | Title | Journal |
22300067 | 20120203 | Suppressive effects of liquid crystal compounds on the growth of U937 human leukemic monocyte lymphoma cells | Cancer cell international |
21733750 | 20111015 | Synthesis, X-ray crystal structure and fluorescent spectra of novel pyrazolo[1,5-a]pyrazin-4(5H)-one derivatives | Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy |
21640587 | 20110701 | Synthesis of novel pyrazolo[1,5-a]pyrazin-4(5H)-one derivatives and their inhibition against growth of A549 and H322 lung cancer cells | Bioorganic & medicinal chemistry letters |
21463913 | 20110601 | Microwave-assisted synthesis, crystal structure of pyrazolo[1,5-a]pyrazin-4(5H)-ones and their selective effects on lung cancer cells | European journal of medicinal chemistry |
19013820 | 20081215 | Synthesis and preliminary biological evaluation of novel pyrazolo[1,5-a]pyrazin-4(5H)-one derivatives as potential agents against A549 lung cancer cells | Bioorganic & medicinal chemistry |
Complexity: | 189 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 135.043261791 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 135.043261791 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 46.9Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS