Phenyl-2-aminobenzenesulfonate - CAS 68227-69-0
Catalog: |
BB033496 |
Product Name: |
Phenyl-2-aminobenzenesulfonate |
CAS: |
68227-69-0 |
Synonyms: |
phenyl 2-aminobenzenesulfonate |
IUPAC Name: | phenyl 2-aminobenzenesulfonate |
Description: | Phenyl-2-aminobenzenesulfonate (CAS# 68227-69-0) is a useful research chemical compound. |
Molecular Weight: | 249.29 |
Molecular Formula: | C12H11NO3S |
Canonical SMILES: | C1=CC=C(C=C1)OS(=O)(=O)C2=CC=CC=C2N |
InChI: | InChI=1S/C12H11NO3S/c13-11-8-4-5-9-12(11)17(14,15)16-10-6-2-1-3-7-10/h1-9H,13H2 |
InChI Key: | DELFPZLNAZAZRE-UHFFFAOYSA-N |
Boiling Point: | 435 ℃ at 760 mmHg |
Melting Point: | 70-73 ℃ |
Purity: | 95 % |
Density: | 1.344 g/cm3 |
Appearance: | Grayish yellow powder |
MDL: | MFCD03093960 |
LogP: | 3.69850 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021066080-A1 | Drug, drug manufacturing method, and water purification method | 20191001 |
CN-108080236-A | A kind of method for promoting desulfurizing dust-collector shell corrosion resistance | 20171130 |
CN-110769931-A | Catalyst for generating free radical, method for producing oxidation reaction product, chemical, and chemical for agricultural and livestock use | 20170617 |
EP-3626339-A1 | Radical-generating catalyst, radical production method, oxidation reaction product production method, chemical agent, and chemical agent for agriculture and livestock | 20170617 |
JP-WO2018230743-A1 | Radical generating catalyst, radical production method, oxidation reaction product production method, drug and agricultural and livestock drug | 20170617 |
Complexity: | 330 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 249.04596439 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 249.04596439 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 77.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS