Phenethyldiphenylphosphine - CAS 5952-49-8
Catalog: |
BB030408 |
Product Name: |
Phenethyldiphenylphosphine |
CAS: |
5952-49-8 |
Synonyms: |
diphenyl(2-phenylethyl)phosphine; diphenyl(2-phenylethyl)phosphane |
IUPAC Name: | diphenyl(2-phenylethyl)phosphane |
Description: | Phenethyldiphenylphosphine (CAS# 5952-49-8 ) is a useful research chemical. |
Molecular Weight: | 290.34 |
Molecular Formula: | C20H19P |
Canonical SMILES: | C1=CC=C(C=C1)CCP(C2=CC=CC=C2)C3=CC=CC=C3 |
InChI: | InChI=1S/C20H19P/c1-4-10-18(11-5-1)16-17-21(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
InChI Key: | NNLYMENHIVUOLT-UHFFFAOYSA-N |
LogP: | 4.36200 |
Publication Number | Title | Priority Date |
WO-2019243581-A1 | Tetra-nuclear neutral copper (i) complexes with diarylphosphine ligands | 20180620 |
JP-6738447-B2 | Decorative boards and floor materials | 20180207 |
CA-2944439-A1 | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
CN-106165175-A | High molecular electrolyte composition and use its polyelectrolyte membrane, film electrode composite element and polymer electrolyte fuel cell | 20140407 |
EP-3131145-A1 | Polymer electrolyte composition and polymer electrolyte membrane, membrane-electrolyte assembly, and solid polymer fuel cell using same | 20140407 |
Complexity: | 252 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 290.122437604 |
Formal Charge: | 0 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 290.122437604 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Phosphorus Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS