O-(4-Methoxybenzyl)hydroxylamine Hydrochloride - CAS 876-33-5
Catalog: |
BB038562 |
Product Name: |
O-(4-Methoxybenzyl)hydroxylamine Hydrochloride |
CAS: |
876-33-5 |
Synonyms: |
O-[(4-methoxyphenyl)methyl]hydroxylamine;hydrochloride; O-[(4-methoxyphenyl)methyl]hydroxylamine;hydrochloride |
IUPAC Name: | O-[(4-methoxyphenyl)methyl]hydroxylamine;hydrochloride |
Description: | O-(4-Methoxybenzyl)hydroxylamine Hydrochloride (CAS# 876-33-5) is a useful research chemical. |
Molecular Weight: | 189.64 |
Molecular Formula: | C8H12ClNO2 |
Canonical SMILES: | COC1=CC=C(C=C1)CON.Cl |
InChI: | InChI=1S/C8H11NO2.ClH/c1-10-8-4-2-7(3-5-8)6-11-9;/h2-5H,6,9H2,1H3;1H |
InChI Key: | DHEZQYZJFCIQQA-UHFFFAOYSA-N |
Boiling Point: | 286.5 ℃ at 760 mmHg |
MDL: | MFCD01114582 |
LogP: | 2.58780 |
Publication Number | Title | Priority Date |
WO-2021066149-A1 | Pharmaceutical composition and kit characterized by containing novel penam derivative or salt thereof and one or more compounds selected from β-lactamase inhibitor compound, antibacterial compound and salts of these | 20191004 |
TW-202005969-A | Novel penicillin derivatives or their salts, pharmaceutical compositions and their applications | 20180406 |
WO-2019194306-A1 | Novel penam derivatives or salts thereof, pharmaceutical compositions and use thereof | 20180406 |
AU-2019249008-A1 | Novel penam derivatives or salts thereof, pharmaceutical compositions and use thereof | 20180406 |
CN-111954673-A | Novel penam derivative or salt thereof, pharmaceutical composition, and use thereof | 20180406 |
Complexity: | 100 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.0556563 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.0556563 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 44.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS