N4-Benzoylcytosine - CAS 26661-13-2
Catalog: |
BB019337 |
Product Name: |
N4-Benzoylcytosine |
CAS: |
26661-13-2 |
Synonyms: |
N-(2-oxo-1H-pyrimidin-6-yl)benzamide |
IUPAC Name: | N-(2-oxo-1H-pyrimidin-6-yl)benzamide |
Description: | N4-Benzoylcytosine (CAS# 26661-13-2) is a reactant in the synthesis of 1',2'-cyclopentyl nucleosides as potential antiviral agents. |
Molecular Weight: | 215.21 |
Molecular Formula: | C11H9N3O2 |
Canonical SMILES: | C1=CC=C(C=C1)C(=O)NC2=CC=NC(=O)N2 |
InChI: | InChI=1S/C11H9N3O2/c15-10(8-4-2-1-3-5-8)13-9-6-7-12-11(16)14-9/h1-7H,(H2,12,13,14,15,16) |
InChI Key: | XBDUZBHKKUFFRH-UHFFFAOYSA-N |
Melting Point: | >300 ℃ (dec.) |
Purity: | 95 % |
Density: | 1.33 g/cm3 |
Appearance: | Solid |
MDL: | MFCD00239434 |
LogP: | 1.09520 |
GHS Hazard Statement: | H302 (95.35%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021211928-A1 | Compositions and methods of inhibiting severe acute respiratory syndrome coronavirus 2 (sars-cov-2) | 20200417 |
WO-2021202788-A2 | Modified oligomeric compounds and uses thereof | 20200403 |
WO-2021202557-A1 | Spherical nucleic acids (snas) for regulation of frataxin | 20200330 |
WO-2021195446-A2 | Methods and compositions for restoring stmn2 levels | 20200325 |
WO-2021195295-A1 | Bifunctional molecules and methods of using thereof | 20200324 |
PMID | Publication Date | Title | Journal |
22530902 | 20120501 | Synthesis and biological evaluation of 3'-C-ethynyl and 3'-C-(1,4-disubstituted-1,2,3-triazolo) double-headed pyranonucleosides | Medicinal chemistry (Shariqah (United Arab Emirates)) |
21917363 | 20111101 | Branched-chain C-cyano pyranonucleosides: synthesis of 3'-C-cyano & 3'-C-cyano-3'-deoxy pyrimidine pyranonucleosides as novel cytotoxic agents | European journal of medicinal chemistry |
21330014 | 20110401 | Synthesis and biological evaluation of unsaturated keto and exomethylene D-arabinopyranonucleoside analogs: novel 5-fluorouracil analogs that target thymidylate synthase | European journal of medicinal chemistry |
20674371 | 20100901 | Novel nucleosides as potent influenza viral inhibitors | Bioorganic & medicinal chemistry |
20018340 | 20100401 | Synthesis of 4,6-dideoxy-3-fluoro-2-keto-beta-D-glucopyranosyl analogues of 5-fluorouracil, N6-benzoyl adenine, uracil, thymine, N4-benzoyl cytosine and evaluation of their antitumor activities | Bioorganic chemistry |
Complexity: | 354 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 215.069476538 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 215.069476538 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 70.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS