N,N,N',N'-Tetraethylethylenediamine - CAS 150-77-6
Catalog: |
BB010574 |
Product Name: |
N,N,N',N'-Tetraethylethylenediamine |
CAS: |
150-77-6 |
Synonyms: |
N,N,N',N'-tetraethylethane-1,2-diamine |
IUPAC Name: | N,N,N',N'-tetraethylethane-1,2-diamine |
Description: | N,N,N',N'-Tetraethylethylenediamine (CAS# 150-77-6) is a useful research chemical. |
Molecular Weight: | 172.31 |
Molecular Formula: | C10H24N2 |
Canonical SMILES: | CCN(CC)CCN(CC)CC |
InChI: | InChI=1S/C10H24N2/c1-5-11(6-2)9-10-12(7-3)8-4/h5-10H2,1-4H3 |
InChI Key: | DIHKMUNUGQVFES-UHFFFAOYSA-N |
Boiling Point: | 190 ℃ |
Flash Point: | 58 °C |
Purity: | 99 % |
Density: | 0.808 g/mL at 25 ℃ (lit.) |
Appearance: | Colorless to light yellow to light orange clear liquid |
MDL: | MFCD00009055 |
LogP: | 1.67000 |
Refractive Index: | 1.43 |
GHS Hazard Statement: | H226 (82.28%): Flammable liquid and vapor [Warning Flammable liquids]; H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P501 P240 P210 P233 P243 P241 P242 P264 P280 P370 + P378 P303 + P361 + P353 P301 + P330 + P331 P363 P304 + P340 + P310 P305 + P351 + P338 + P310 P403 + P235 P405 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2021155983-A1 | Cyclooctatetraene containing dyes and compositions | 20191127 |
WO-2021104845-A1 | Cyclooctatetraene containing dyes and compositions | 20191127 |
WO-2021074342-A1 | Low gloss polyurethane coating compositions | 20191017 |
US-2021079170-A1 | Preparation method of 4d chitosan-based thermosensitive hydrogel | 20190916 |
WO-2021047928-A1 | Process for removal of acid gases from a fluid stream | 20190910 |
PMID | Publication Date | Title | Journal |
22667984 | 20120618 | Synthesis and structural diversity of barium (N,N-dimethylamino)diboranates | Inorganic chemistry |
19653691 | 20090902 | Practical catalytic asymmetric synthesis of diaryl-, aryl heteroaryl-, and diheteroarylmethanols | Journal of the American Chemical Society |
18842047 | 20081105 | Lithiation of TMEDA and its higher homologous TEEDA: understanding observed alpha- and beta-deprotonation | Journal of the American Chemical Society |
18052173 | 20071226 | Catalytic asymmetric generation of (Z)-disubstituted allylic alcohols | Journal of the American Chemical Society |
17900107 | 20071029 | Synthesis, characterization, and reactivity of ruthenium diene/diamine complexes including catalytic hydrogenation of ketones | Inorganic chemistry |
Complexity: | 73.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.193948774 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.193948774 |
Rotatable Bond Count: | 7 |
Topological Polar Surface Area: | 6.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS