N,N-Diisopropylformamide - CAS 2700-30-3
Catalog: |
BB019435 |
Product Name: |
N,N-Diisopropylformamide |
CAS: |
2700-30-3 |
Synonyms: |
N,N-di(propan-2-yl)formamide |
IUPAC Name: | N,N-di(propan-2-yl)formamide |
Description: | N,N-Diisopropylformamide can be used for catalytic activity. |
Molecular Weight: | 129.20 |
Molecular Formula: | C7H15NO |
Canonical SMILES: | CC(C)N(C=O)C(C)C |
InChI: | InChI=1S/C7H15NO/c1-6(2)8(5-9)7(3)4/h5-7H,1-4H3 |
InChI Key: | UNBDDZDKBWPHAX-UHFFFAOYSA-N |
Boiling Point: | 196 °C (lit.) |
Density: | 0.89 g/mL at 25 °C (lit.) |
Appearance: | Clear light brown liquid |
MDL: | MFCD00008867 |
LogP: | 1.89750 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P302+P352, P303+P361+P353, P304+P312, P304+P340, P305+P351+P338, P310, P312, P321, P322, P330, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
JP-2020203942-A | Method for producing perfluoroalkaziene compound | 20200916 |
JP-2020200335-A | Method for producing perfluoroalkaziene compound | 20200825 |
JP-2020125356-A | Method for producing hexafluorobutadiene | 20200512 |
WO-2021183922-A1 | Stabilization of carbon deposition precursors like c2h2 | 20200313 |
WO-2021085370-A1 | Azole derivative and use thereof | 20191031 |
PMID | Publication Date | Title | Journal |
12666251 | 20030301 | Cyclohex-1-ene carboxylic acids: synthesis and biological evaluation of novel inhibitors of human 5 alpha reductase | Archiv der Pharmazie |
Complexity: | 80.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 129.115364102 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 129.115364102 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 20.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS