N-Methyl-2,4-dichlorobenzylamine Hydrochloride - CAS 90389-07-4
Catalog: |
BB039826 |
Product Name: |
N-Methyl-2,4-dichlorobenzylamine Hydrochloride |
CAS: |
90389-07-4 |
Synonyms: |
1-(2,4-dichlorophenyl)-N-methylmethanamine;hydrochloride; 1-(2,4-dichlorophenyl)-N-methylmethanamine;hydrochloride |
IUPAC Name: | 1-(2,4-dichlorophenyl)-N-methylmethanamine;hydrochloride |
Description: | N-Methyl-2,4-dichlorobenzylamine Hydrochloride (CAS# 90389-07-4) is a useful research chemical. |
Molecular Weight: | 226.53 |
Molecular Formula: | C8H10Cl3N |
Canonical SMILES: | CNCC1=C(C=C(C=C1)Cl)Cl.Cl |
InChI: | InChI=1S/C8H9Cl2N.ClH/c1-11-5-6-2-3-7(9)4-8(6)10;/h2-4,11H,5H2,1H3;1H |
InChI Key: | YDLOOYIAVJPBIT-UHFFFAOYSA-N |
Boiling Point: | 278.3 ℃ at 760 mmHg |
MDL: | MFCD04117880 |
LogP: | 3.90570 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-2076492-A2 | Non-nucleoside reverse transcriptase inhibitors | 20061006 |
JP-2010505834-A | Non-nucleoside reverse transcriptase inhibitors | 20061006 |
US-2010113421-A1 | Non-nucleoside reverse transcriptase inhibitors | 20061006 |
WO-2008054605-A2 | Non-nucleoside reverse transcriptase inhibitors | 20061006 |
JP-2004525177-A | Piperazine derivatives as tachykinin antagonists | 20010405 |
PMID | Publication Date | Title | Journal |
6433022 | 19840901 | Benzylamines: synthesis and evaluation of antimycobacterial properties | Journal of medicinal chemistry |
Complexity: | 119 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.987882 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.987882 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 12 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS