N-Cyanoacetylurethane - CAS 6629-04-5
Catalog: |
BB032976 |
Product Name: |
N-Cyanoacetylurethane |
CAS: |
6629-04-5 |
Synonyms: |
ethyl N-(2-cyanoacetyl)carbamate |
IUPAC Name: | ethyl N-(2-cyanoacetyl)carbamate |
Description: | N-Cyanoacetylurethane (CAS# 6629-04-5) is used in the synthesis of inhibitors targetting the PDZ domain of PICK1, which is a potential target for brain ischemia, pain and addiction illnesses. Also it is used in the synthesis of cathespin K inhibitors. |
Molecular Weight: | 156.14 |
Molecular Formula: | C6H8N2O3 |
Canonical SMILES: | CCOC(=O)NC(=O)CC#N |
InChI: | InChI=1S/C6H8N2O3/c1-2-11-6(10)8-5(9)3-4-7/h2-3H2,1H3,(H,8,9,10) |
InChI Key: | HSOGVWWWGVFXGF-UHFFFAOYSA-N |
Melting Point: | 167-169 ℃ (lit.) |
Purity: | 95 % |
Density: | 1.197 g/cm3 |
MDL: | MFCD00001937 |
LogP: | 0.56368 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112645936-A | Substituted pyridazinone compound and use thereof | 20201217 |
US-2021230146-A1 | Thyroid hormone receptor agonists and use thereof | 20200113 |
WO-2021143706-A1 | Substituted triazinones as thyroid hormone receptor agonists | 20200113 |
WO-2021121210-A1 | Fused-ring derivative, and preparation method therefor and medical use thereof | 20191216 |
CN-112707892-A | Pyridazinone or pyridazine compound and derivative and pharmaceutical composition thereof | 20191024 |
Complexity: | 203 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 156.05349212 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 156.05349212 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 79.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS