N-Boc-4-ethynylcyclohexanamine - CAS 1824233-64-8
Catalog: |
BB013984 |
Product Name: |
N-Boc-4-ethynylcyclohexanamine |
CAS: |
1824233-64-8 |
Synonyms: |
N-(4-ethynylcyclohexyl)carbamic acid tert-butyl ester; tert-butyl N-(4-ethynylcyclohexyl)carbamate |
IUPAC Name: | tert-butyl N-(4-ethynylcyclohexyl)carbamate |
Description: | N-Boc-4-ethynylcyclohexanamine (CAS# 1824233-64-8 ) is a useful research chemical. |
Molecular Weight: | 223.31 |
Molecular Formula: | C13H21NO2 |
Canonical SMILES: | CC(C)(C)OC(=O)NC1CCC(CC1)C#C |
InChI: | InChI=1S/C13H21NO2/c1-5-10-6-8-11(9-7-10)14-12(15)16-13(2,3)4/h1,10-11H,6-9H2,2-4H3,(H,14,15) |
InChI Key: | NZTBBJYAWNVCOE-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
KR-20200101219-A | Novel heterotricyclic derivatives and use thereof | 20190219 |
TW-202045512-A | Novel heterotricyclic derivatives and use thereof | 20190219 |
WO-2020171606-A1 | Novel heterotricyclic derivative compound and use of same | 20190219 |
CN-113423710-A | Novel heterocyclic tricyclic derivative compound and use thereof | 20190219 |
TW-201802081-A | Compounds and their use in reducing uric acid levels (1) | 20160630 |
Complexity: | 287 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 223.157228913 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 223.157228913 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 38.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS