N-Boc-3-(hydroxymethyl)-3-methylpyrrolidine - CAS 1263506-20-2
Catalog: |
BB006580 |
Product Name: |
N-Boc-3-(hydroxymethyl)-3-methylpyrrolidine |
CAS: |
1263506-20-2 |
Synonyms: |
3-(hydroxymethyl)-3-methyl-1-pyrrolidinecarboxylic acid tert-butyl ester; tert-butyl 3-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate |
IUPAC Name: | tert-butyl 3-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate |
Description: | N-Boc-3-(hydroxymethyl)-3-methylpyrrolidine (CAS# 1263506-20-2) is a useful research chemical. |
Molecular Weight: | 215.29 |
Molecular Formula: | C11H21NO3 |
Canonical SMILES: | CC1(CCN(C1)C(=O)OC(C)(C)C)CO |
InChI: | InChI=1S/C11H21NO3/c1-10(2,3)15-9(14)12-6-5-11(4,7-12)8-13/h13H,5-8H2,1-4H3 |
InChI Key: | OMMHAHKCMUUEOY-UHFFFAOYSA-N |
Appearance: | Liquid |
LogP: | 1.56370 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021030711-A1 | Alkynyl quinazoline compounds | 20190815 |
WO-2019243527-A1 | Oga inhibitor compounds | 20180620 |
TW-202012392-A | OGA inhibitor compounds | 20180620 |
CN-112292377-A | OGA inhibitor compounds | 20180620 |
EP-3810594-A1 | Oga inhibitor compounds | 20180620 |
Complexity: | 247 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 215.15214353 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 215.15214353 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 49.8 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS