N-Boc-3-hydroxy-4-methylenepiperidine - CAS 159635-22-0
Catalog: |
BB011555 |
Product Name: |
N-Boc-3-hydroxy-4-methylenepiperidine |
CAS: |
159635-22-0 |
Synonyms: |
3-hydroxy-4-methylene-1-piperidinecarboxylic acid tert-butyl ester; tert-butyl 3-hydroxy-4-methylidenepiperidine-1-carboxylate |
IUPAC Name: | tert-butyl 3-hydroxy-4-methylidenepiperidine-1-carboxylate |
Description: | N-Boc-3-hydroxy-4-methylenepiperidine (CAS# 159635-22-0) is a useful research chemical. |
Molecular Weight: | 213.27 |
Molecular Formula: | C11H19NO3 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CCC(=C)C(C1)O |
InChI: | InChI=1S/C11H19NO3/c1-8-5-6-12(7-9(8)13)10(14)15-11(2,3)4/h9,13H,1,5-7H2,2-4H3 |
InChI Key: | IMRNHROGUGVTAI-UHFFFAOYSA-N |
Boiling Point: | 309.018 ℃ at 760 mmHg |
Density: | 1.092 g/cm3 |
MDL: | MFCD15474939 |
LogP: | 1.48220 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2014336153-A1 | Substituted pyridine derivatives as fabi inhibitors | 20111202 |
US-9062002-B2 | Substituted pyridine derivatives as FabI inhibitors | 20111202 |
WO-2013080222-A1 | Substituted pyridine derivatives as fabi inhibitors | 20111202 |
WO-2013010453-A1 | Chemoking receptor antagonists | 20110715 |
CA-2776914-A1 | Diazepan derivatives as modulators of chemokine receptors | 20091021 |
Complexity: | 268 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.13649347 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.13649347 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 49.8 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS