N-Boc-3,5-dioxopiperidine - CAS 396731-40-1
Catalog: |
BB024082 |
Product Name: |
N-Boc-3,5-dioxopiperidine |
CAS: |
396731-40-1 |
Synonyms: |
3,5-dioxo-1-piperidinecarboxylic acid tert-butyl ester; tert-butyl 3,5-dioxopiperidine-1-carboxylate |
IUPAC Name: | tert-butyl 3,5-dioxopiperidine-1-carboxylate |
Description: | N-Boc-3,5-dioxopiperidine (CAS# 396731-40-1) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 213.23 |
Molecular Formula: | C10H15NO4 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CC(=O)CC(=O)C1 |
InChI: | InChI=1S/C10H15NO4/c1-10(2,3)15-9(14)11-5-7(12)4-8(13)6-11/h4-6H2,1-3H3 |
InChI Key: | KWNDKZADLGFSKE-UHFFFAOYSA-N |
LogP: | 0.70330 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021127356-A1 | Substituted Bicyclic and Tricyclic Ureas and Amides, Analogues Thereof, and Methods Using Same | 20191220 |
WO-2020239077-A1 | Nitrogen-containing heterocyclic derivative regulator, preparation method therefor and application thereof | 20190529 |
EP-3604309-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20180730 |
WO-2020025587-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20180730 |
US-2021277019-A1 | Heterocyclic Compounds And Their Use in Preventing or Treating Bacterial Infections | 20180730 |
Complexity: | 287 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.10010796 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.10010796 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 63.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperidones
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS