N-Boc-1-(4-bromophenyl)cyclobutanamine - CAS 1032350-06-3
Catalog: |
BB001055 |
Product Name: |
N-Boc-1-(4-bromophenyl)cyclobutanamine |
CAS: |
1032350-06-3 |
Synonyms: |
N-[1-(4-bromophenyl)cyclobutyl]carbamic acid tert-butyl ester; tert-butyl N-[1-(4-bromophenyl)cyclobutyl]carbamate |
IUPAC Name: | tert-butyl N-[1-(4-bromophenyl)cyclobutyl]carbamate |
Description: | N-Boc-1-(4-bromophenyl)cyclobutanamine (CAS# 1032350-06-3) is a useful research chemical. |
Molecular Weight: | 326.23 |
Molecular Formula: | C15H20BrNO2 |
Canonical SMILES: | CC(C)(C)OC(=O)NC1(CCC1)C2=CC=C(C=C2)Br |
InChI: | InChI=1S/C15H20BrNO2/c1-14(2,3)19-13(18)17-15(9-4-10-15)11-5-7-12(16)8-6-11/h5-8H,4,9-10H2,1-3H3,(H,17,18) |
InChI Key: | DVTBDRZBNXFPLU-UHFFFAOYSA-N |
MDL: | MFCD18072661 |
LogP: | 4.74390 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112979747-A | Hydroxyproline derivative for preparing protein degradation targeting chimera | 20191216 |
CN-112457367-A | Interlinking compound as protein degradation agent and preparation method and application thereof | 20190906 |
AU-2016338118-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
Complexity: | 326 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 325.06774 |
Formal Charge: | 0 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 325.06774 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 38.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS