N-(Allyloxy)-2-nitrobenzenesulfonamide - CAS 359442-67-4
Catalog: |
BB022807 |
Product Name: |
N-(Allyloxy)-2-nitrobenzenesulfonamide |
CAS: |
359442-67-4 |
Synonyms: |
2-nitro-N-prop-2-enoxybenzenesulfonamide; 2-nitro-N-prop-2-enoxybenzenesulfonamide |
IUPAC Name: | 2-nitro-N-prop-2-enoxybenzenesulfonamide |
Description: | N-(Allyloxy)-2-nitrobenzenesulfonamide (CAS# 359442-67-4) is a useful research chemical compound. |
Molecular Weight: | 258.25 |
Molecular Formula: | C9H10N2O5S |
Canonical SMILES: | C=CCONS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
InChI: | InChI=1S/C9H10N2O5S/c1-2-7-16-10-17(14,15)9-6-4-3-5-8(9)11(12)13/h2-6,10H,1,7H2 |
InChI Key: | LCFNIMWVJDLNSM-UHFFFAOYSA-N |
MDL: | MFCD01413818 |
LogP: | 2.98560 |
Publication Number | Title | Priority Date |
EP-3604315-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20180730 |
EP-3300736-A1 | Composition comprising antibiotic compound and an heterocyclic compound and their use in preventing or treating bacterial infections | 20160930 |
EP-3301094-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20160930 |
TW-201815390-A | Composition comprising antibiotic compound and heterocyclic compound and use thereof for preventing or treating bacterial infection | 20160930 |
US-2019224210-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20160930 |
Complexity: | 370 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 258.0310426 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 258.0310426 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 110 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[21178-14-3]
N,N'-Dimethyl-2,7-diazapyrenium difluoroborate
-
[1082828-31-6]
Ethyl 5-bromo-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate
-
[597-35-3]
ethylsulfone
-
[852913-16-7]
N-[3,5-Bis(trifluoromethyl)phenyl]-N-[(8a,9S)-6-methoxy-9-cinchonanyl]thiourea
-
[79551-14-7]
Ferene Disodium Salt
INDUSTRY LEADERS TRUST OUR PRODUCTS