N-[(4-Pyridyl)methyl]cyclopropanamine - CAS 193153-60-5
Catalog: |
BB014927 |
Product Name: |
N-[(4-Pyridyl)methyl]cyclopropanamine |
CAS: |
193153-60-5 |
Synonyms: |
N-(pyridin-4-ylmethyl)cyclopropanamine; N-(pyridin-4-ylmethyl)cyclopropanamine |
IUPAC Name: | N-(pyridin-4-ylmethyl)cyclopropanamine |
Description: | N-[(4-Pyridyl)methyl]cyclopropanamine (CAS# 193153-60-5) is a useful research chemical. |
Molecular Weight: | 148.20 |
Molecular Formula: | C9H12N2 |
Canonical SMILES: | C1CC1NCC2=CC=NC=C2 |
InChI: | InChI=1S/C9H12N2/c1-2-9(1)11-7-8-3-5-10-6-4-8/h3-6,9,11H,1-2,7H2 |
InChI Key: | FKVLLYTWAGEYSO-UHFFFAOYSA-N |
Boiling Point: | 261 °C at 760 mmHg |
Density: | 1.07 g/cm3 |
MDL: | MFCD03821870 |
LogP: | 1.72450 |
Publication Number | Title | Priority Date |
EP-3509627-A1 | Lysine specific histone demethylase-1 inhibitors and uses therefor | 20160907 |
WO-2018045422-A1 | Lysine specific histone demethylase-1 inhibitors and uses therefor | 20160907 |
AU-2008319735-A1 | Pyridazinone derivatives and use thereof as P2X7 receptor inhibitors | 20071031 |
CA-2699631-A1 | Pyridazinone compounds and p2x7 receptor inhibitors | 20071031 |
CN-101842359-A | Pyridazinone derivatives and use thereof as p2x7 receptor inhibitors | 20071031 |
Complexity: | 115 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 148.100048391 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 148.100048391 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 24.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS