N-(4-Formyl-2-thiazolyl)acetamide - CAS 16444-13-6
Catalog: |
BB012108 |
Product Name: |
N-(4-Formyl-2-thiazolyl)acetamide |
CAS: |
16444-13-6 |
Synonyms: |
N-(4-formyl-2-thiazolyl)acetamide; N-(4-formyl-1,3-thiazol-2-yl)acetamide |
IUPAC Name: | N-(4-formyl-1,3-thiazol-2-yl)acetamide |
Description: | N-(4-Formyl-2-thiazolyl)acetamide (CAS# 16444-13-6) is a useful research chemical. |
Molecular Weight: | 170.19 |
Molecular Formula: | C6H6N2O2S |
Canonical SMILES: | CC(=O)NC1=NC(=CS1)C=O |
InChI: | InChI=1S/C6H6N2O2S/c1-4(10)7-6-8-5(2-9)3-11-6/h2-3H,1H3,(H,7,8,10) |
InChI Key: | KBQWZCGLPJQCAU-UHFFFAOYSA-N |
Appearance: | Solid |
LogP: | 1.56350 |
Publication Number | Title | Priority Date |
AU-2009252214-A1 | Benzene or thiophene derivative and use thereof as VAP-1 inhibitor | 20080530 |
AU-2009252214-B2 | Benzene or thiophene derivative and use thereof as VAP-1 inhibitor | 20080530 |
AU-2014274536-A1 | Benzene or thiophene derivative and use thereof as vap-1 inhibitor | 20080530 |
CA-2725110-A1 | Benzene or thiophene derivative and use thereof as vap-1 inhibitor | 20080530 |
EP-2300430-A1 | Benzene or thiophene derivative and use thereof as vap-1 inhibitor | 20080530 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 170.01499861 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 170.01499861 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 87.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS