N,2-Dimethylbenzylamine - CAS 874-33-9
Catalog: |
BB038452 |
Product Name: |
N,2-Dimethylbenzylamine |
CAS: |
874-33-9 |
Synonyms: |
N-methyl-1-(2-methylphenyl)methanamine; N-methyl-1-(2-methylphenyl)methanamine |
IUPAC Name: | N-methyl-1-(2-methylphenyl)methanamine |
Description: | N,2-Dimethylbenzylamine (CAS# 874-33-9) is a useful research chemical. |
Molecular Weight: | 135.21 |
Molecular Formula: | C9H13N |
Canonical SMILES: | CC1=CC=CC=C1CNC |
InChI: | InChI=1S/C9H13N/c1-8-5-3-4-6-9(8)7-10-2/h3-6,10H,7H2,1-2H3 |
InChI Key: | YMWQUYQBTXWNAH-UHFFFAOYSA-N |
Boiling Point: | 196.5 °C at 760 mmHg |
LogP: | 2.10530 |
GHS Hazard Statement: | H227 (100%): Combustible liquid [Warning Flammable liquids] |
Precautionary Statement: | P210, P261, P264, P271, P280, P304+P340, P305+P351+P338, P310, P312, P337+P313, P370+P378, P403+P233, P403+P235, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
JP-2021098691-A | Compounds that are active against nuclear receptors | 20191220 |
US-2021188807-A1 | Compounds active towards nuclear receptors | 20191220 |
WO-2021124279-A1 | Compounds active towards nuclear receptors | 20191220 |
WO-2021072203-A1 | Tgfbetar1 inhibitor-asgr antibody conjugates and uses thereof | 20191009 |
WO-2021030620-A1 | Heterocyclic compounds as kinase inhibitors | 20190814 |
Complexity: | 90.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 135.104799419 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 135.104799419 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 12 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS