Morpholino(2-piperidinyl)methanone Hydrochloride - CAS 690634-79-8
Catalog: |
BB033689 |
Product Name: |
Morpholino(2-piperidinyl)methanone Hydrochloride |
CAS: |
690634-79-8 |
Synonyms: |
4-morpholinyl(2-piperidinyl)methanone;hydrochloride; morpholin-4-yl(piperidin-2-yl)methanone;hydrochloride |
IUPAC Name: | morpholin-4-yl(piperidin-2-yl)methanone;hydrochloride |
Description: | Morpholino(2-piperidinyl)methanone Hydrochloride (CAS# 690634-79-8) is a useful research chemical. |
Molecular Weight: | 234.72 |
Molecular Formula: | C10H19ClN2O2 |
Canonical SMILES: | C1CCNC(C1)C(=O)N2CCOCC2.Cl |
InChI: | InChI=1S/C10H18N2O2.ClH/c13-10(9-3-1-2-4-11-9)12-5-7-14-8-6-12;/h9,11H,1-8H2;1H |
InChI Key: | QTMPLCRQSUNTJY-UHFFFAOYSA-N |
Boiling Point: | 369.8 °C at 760 mmHg |
Density: | 1.111 g/cm3 |
MDL: | MFCD05865124 |
LogP: | 1.05600 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CA-2866302-A1 | Carbamate compounds and of making and using same | 20120319 |
EP-2828253-A1 | Carbamate compounds and of making and using same | 20120319 |
JP-2015510938-A | Carbamate compounds and their production and use | 20120319 |
JP-6100883-B2 | Carbamate compounds and their production and use | 20120319 |
US-2015080364-A1 | Carbamate compounds and of making and using same | 20120319 |
Complexity: | 202 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 234.1135055 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 234.1135055 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 41.6 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Morpholines/Thiomorpholines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS