Methyl 6-Quinolineacetate - CAS 5622-36-6
Catalog: |
BB029299 |
Product Name: |
Methyl 6-Quinolineacetate |
CAS: |
5622-36-6 |
Synonyms: |
2-(6-quinolinyl)acetic acid methyl ester; methyl 2-quinolin-6-ylacetate |
IUPAC Name: | methyl 2-quinolin-6-ylacetate |
Description: | Methyl 6-Quinolineacetate (CAS# 5622-36-6) is a reactuant to prepare triazolopyridazines as tyrosine kinase modulators. |
Molecular Weight: | 201.22 |
Molecular Formula: | C12H11NO2 |
Canonical SMILES: | COC(=O)CC1=CC2=C(C=C1)N=CC=C2 |
InChI: | InChI=1S/C12H11NO2/c1-15-12(14)8-9-4-5-11-10(7-9)3-2-6-13-11/h2-7H,8H2,1H3 |
InChI Key: | PCUOFKCRVNHDEB-UHFFFAOYSA-N |
Boiling Point: | 560.2 °C at 760 mmHg |
Density: | 1.194 g/cm3 |
LogP: | 1.95030 |
Publication Number | Title | Priority Date |
WO-2020251871-A2 | Novel substituted tetrahydroquinolin compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20190611 |
WO-2019089412-A1 | Novel substituted tetrahydroquinolin compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20171101 |
EP-3703692-A1 | Novel substituted tetrahydroquinolin compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20171101 |
US-2021179607-A1 | Novel substituted tetrahydroquinolin compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20171101 |
AU-2017319500-A1 | Inhibitors of cellular metabolic processes | 20160831 |
Complexity: | 230 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.078978594 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.078978594 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 39.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS