Methyl 6-Chloro-4-methylnicotinate - CAS 1224464-97-4
Catalog: |
BB005400 |
Product Name: |
Methyl 6-Chloro-4-methylnicotinate |
CAS: |
1224464-97-4 |
Synonyms: |
6-chloro-4-methyl-3-pyridinecarboxylic acid methyl ester; methyl 6-chloro-4-methylpyridine-3-carboxylate |
IUPAC Name: | methyl 6-chloro-4-methylpyridine-3-carboxylate |
Description: | Methyl 6-Chloro-4-methylnicotinate (CAS# 1224464-97-4) is a useful research chemical. |
Molecular Weight: | 185.61 |
Molecular Formula: | C8H8ClNO2 |
Canonical SMILES: | CC1=CC(=NC=C1C(=O)OC)Cl |
InChI: | InChI=1S/C8H8ClNO2/c1-5-3-7(9)10-4-6(5)8(11)12-2/h3-4H,1-2H3 |
InChI Key: | BQVXASUNSLLUGY-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 1.83000 |
Publication Number | Title | Priority Date |
WO-2021158481-A1 | Substituted 1,1'-biphenyl compounds and methods using same | 20200203 |
WO-2020191261-A1 | Indazoles as lrrk2 inhibitors | 20190321 |
WO-2020165834-A1 | Substituted 3-(1-oxoisoindolin-2-yl)piperidine-2,6-dione derivatives and uses thereof | 20190215 |
CN-113329792-A | Substituted 3- (1-oxoisoindolin-2-yl) piperidine-2, 6-dione derivatives and uses thereof | 20190215 |
WO-2020160710-A1 | Imidazo [2, 1-f] [1, 2, 4] triazin-4-amine derivatives as tlr7 agonist | 20190207 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.0243562 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.0243562 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 39.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS