Methyl 5-(Methylamino)nicotinate - CAS 91702-86-2
Catalog: |
BB040324 |
Product Name: |
Methyl 5-(Methylamino)nicotinate |
CAS: |
91702-86-2 |
Synonyms: |
5-(methylamino)-3-pyridinecarboxylic acid methyl ester; methyl 5-(methylamino)pyridine-3-carboxylate |
IUPAC Name: | methyl 5-(methylamino)pyridine-3-carboxylate |
Description: | Methyl 5-(Methylamino)nicotinate (CAS# 91702-86-2) is a useful research chemical. |
Molecular Weight: | 166.18 |
Molecular Formula: | C8H10N2O2 |
Canonical SMILES: | CNC1=CN=CC(=C1)C(=O)OC |
InChI: | InChI=1S/C8H10N2O2/c1-9-7-3-6(4-10-5-7)8(11)12-2/h3-5,9H,1-2H3 |
InChI Key: | XIYNYAIMEJCRCU-UHFFFAOYSA-N |
LogP: | 0.98290 |
Publication Number | Title | Priority Date |
KR-20190127720-A | Macrocyclic broad-spectrum antibiotics | 20170215 |
CN-104024226-A | Novel nicotinamide derivative or salt thereof | 20111228 |
WO-2012097196-A1 | Pyrazolopyrimidine derivatives and uses as anticancer agents | 20110112 |
EP-0110484-A1 | Derivatives of aminopyridinecarboxylic acids, methods for their preparation and pharmaceutical compositions containing them | 19821203 |
EP-0110484-B1 | Derivatives of aminopyridinecarboxylic acids, methods for their preparation and pharmaceutical compositions containing them | 19821203 |
Complexity: | 161 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 166.074227566 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 166.074227566 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 51.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS