Methyl 5-Methyl-2-thiazolecarboxylate - CAS 79247-98-6
Catalog: |
BB036319 |
Product Name: |
Methyl 5-Methyl-2-thiazolecarboxylate |
CAS: |
79247-98-6 |
Synonyms: |
5-methyl-2-thiazolecarboxylic acid methyl ester; methyl 5-methyl-1,3-thiazole-2-carboxylate |
IUPAC Name: | methyl 5-methyl-1,3-thiazole-2-carboxylate |
Description: | Methyl 5-Methyl-2-thiazolecarboxylate (CAS# 79247-98-6) is a useful research chemical. |
Molecular Weight: | 157.19 |
Molecular Formula: | C6H7NO2S |
Canonical SMILES: | CC1=CN=C(S1)C(=O)OC |
InChI: | InChI=1S/C6H7NO2S/c1-4-3-7-5(10-4)6(8)9-2/h3H,1-2H3 |
InChI Key: | RYIXYFPZODBRMO-UHFFFAOYSA-N |
Boiling Point: | 234 °C |
Density: | 1.244 g/cm3 |
MDL: | MFCD01924773 |
LogP: | 1.23810 |
Publication Number | Title | Priority Date |
WO-2020095912-A1 | Benzimidazole derivative | 20181106 |
TW-202031644-A | Benzimidazole derivative | 20181106 |
EP-3564239-A1 | Aryl hydrocarbon receptor modulator | 20161226 |
US-2017226127-A1 | Compounds, compositions and methods | 20160205 |
US-2018022759-A1 | Compounds, compositions and methods | 20160205 |
Complexity: | 140 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 157.01974964 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 157.01974964 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 67.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS